C10H16F3N3O2S — CID 114490303
1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperazine (PubChem CID 114490303) has the molecular formula C10H16F3N3O2S and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperazine.
| Compound Name | 1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperazine |
|---|---|
| PubChem CID | 114490303 |
| Molecular Formula | C10H16F3N3O2S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]piperazine |
| SMILES | O=S(=O)(N1CC=C(C(F)(F)F)CC1)N1CCNCC1 |
| InChI | InChI=1S/C10H16F3N3O2S/c11-10(12,13)9-1-5-15(6-2-9)19(17,18)16-7-3-14-4-8-16/h1,14H,2-8H2 |
| InChIKey | NIJWYTOWFWMBRY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|