C13H21F3N2O2S — CID 114491114
N-[4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]butyl]cyclopropanamine (PubChem CID 114491114) has the molecular formula C13H21F3N2O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]butyl]cyclopropanamine.
| Compound Name | N-[4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]butyl]cyclopropanamine |
|---|---|
| PubChem CID | 114491114 |
| Molecular Formula | C13H21F3N2O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]butyl]cyclopropanamine |
| SMILES | O=S(=O)(CCCCNC1CC1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2O2S/c14-13(15,16)11-5-8-18(9-6-11)21(19,20)10-2-1-7-17-12-3-4-12/h5,12,17H,1-4,6-10H2 |
| InChIKey | ZCTUYJVGAANGHL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|