C9H14N2O2S — CID 107857510
2-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile (PubChem CID 107857510) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile.
| Compound Name | 2-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile |
|---|---|
| PubChem CID | 107857510 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile |
| SMILES | CC1=CCN(S(=O)(=O)C(C)C#N)CC1 |
| InChI | InChI=1S/C9H14N2O2S/c1-8-3-5-11(6-4-8)14(12,13)9(2)7-10/h3,9H,4-6H2,1-2H3 |
| InChIKey | KOVOVPKQPCJGFB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|