C10H16INO2S — CID 138702107
1-cyclopentylsulfonyl-4-iodo-3,6-dihydro-2H-pyridine (PubChem CID 138702107) has the molecular formula C10H16INO2S and a molecular weight of 341.21 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-4-iodo-3,6-dihydro-2H-pyridine.
| Compound Name | 1-cyclopentylsulfonyl-4-iodo-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 138702107 |
| Molecular Formula | C10H16INO2S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-cyclopentylsulfonyl-4-iodo-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(C1CCCC1)N1CC=C(I)CC1 |
| InChI | InChI=1S/C10H16INO2S/c11-9-5-7-12(8-6-9)15(13,14)10-3-1-2-4-10/h5,10H,1-4,6-8H2 |
| InChIKey | YATHGDKFCKKIEY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|