C12H21NO3S — CID 115275106
1-cyclohexylsulfonyl-2,2-dimethylpyrrolidin-3-one (PubChem CID 115275106) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-2,2-dimethylpyrrolidin-3-one.
| Compound Name | 1-cyclohexylsulfonyl-2,2-dimethylpyrrolidin-3-one |
|---|---|
| PubChem CID | 115275106 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-cyclohexylsulfonyl-2,2-dimethylpyrrolidin-3-one |
| SMILES | CC1(C)C(=O)CCN1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H21NO3S/c1-12(2)11(14)8-9-13(12)17(15,16)10-6-4-3-5-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | QAWVEGJAPHDCQE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |