C12H23NO3S — CID 115276192
1-cyclopentylsulfonyl-6,6-dimethylpiperidin-3-ol (PubChem CID 115276192) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-6,6-dimethylpiperidin-3-ol.
| Compound Name | 1-cyclopentylsulfonyl-6,6-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 115276192 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-cyclopentylsulfonyl-6,6-dimethylpiperidin-3-ol |
| SMILES | CC1(C)CCC(O)CN1S(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C12H23NO3S/c1-12(2)8-7-10(14)9-13(12)17(15,16)11-5-3-4-6-11/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | MDGYAIBPMOEUTF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |