C13H25ClO2S — CID 146618987
6,6-dimethylcycloundecane-1-sulfonyl chloride (PubChem CID 146618987) has the molecular formula C13H25ClO2S and a molecular weight of 280.86 g/mol. Its IUPAC name is 6,6-dimethylcycloundecane-1-sulfonyl chloride.
| Compound Name | 6,6-dimethylcycloundecane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 146618987 |
| Molecular Formula | C13H25ClO2S |
| Molecular Weight | 280.86 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 6,6-dimethylcycloundecane-1-sulfonyl chloride |
| SMILES | CC1(C)CCCCCC(S(=O)(=O)Cl)CCCC1 |
| InChI | InChI=1S/C13H25ClO2S/c1-13(2)10-6-3-4-8-12(17(14,15)16)9-5-7-11-13/h12H,3-11H2,1-2H3 |
| InChIKey | XILZWNMYZQTCNE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |