C13H18ClNO — CID 117020860
1-(4-chlorophenyl)-6,6-dimethylpiperidin-3-ol (PubChem CID 117020860) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,6-dimethylpiperidin-3-ol.
| Compound Name | 1-(4-chlorophenyl)-6,6-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 117020860 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(4-chlorophenyl)-6,6-dimethylpiperidin-3-ol |
| SMILES | CC1(C)CCC(O)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO/c1-13(2)8-7-12(16)9-15(13)11-5-3-10(14)4-6-11/h3-6,12,16H,7-9H2,1-2H3 |
| InChIKey | QEUHZXJLBOOGBD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |