C29H34N2O — CID 10071140
4-[(1S,3R)-3-carbazol-9-yl-1-phenylheptyl]morpholine (PubChem CID 10071140) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is 4-[(1S,3R)-3-carbazol-9-yl-1-phenylheptyl]morpholine.
| Compound Name | 4-[(1S,3R)-3-carbazol-9-yl-1-phenylheptyl]morpholine |
|---|---|
| PubChem CID | 10071140 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 4-[(1S,3R)-3-carbazol-9-yl-1-phenylheptyl]morpholine |
| SMILES | CCCC[C@H](C[C@@H](c1ccccc1)N1CCOCC1)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C29H34N2O/c1-2-3-13-24(22-29(23-11-5-4-6-12-23)30-18-20-32-21-19-30)31-27-16-9-7-14-25(27)26-15-8-10-17-28(26)31/h4-12,14-17,24,29H,2-3,13,18-22H2,1H3/t24-,29+/m1/s1 |
| InChIKey | FLZTVEWAPPQSFB-GIGWZHCTSA-N |
| XLogP | 6.99 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |