C20H21N3O3 — CID 42955495
3-(2-morpholin-4-yl-2-phenylethyl)-1H-quinazoline-2,4-dione (PubChem CID 42955495) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-phenylethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-(2-morpholin-4-yl-2-phenylethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 42955495 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-phenylethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CC(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H21N3O3/c24-19-16-8-4-5-9-17(16)21-20(25)23(19)14-18(15-6-2-1-3-7-15)22-10-12-26-13-11-22/h1-9,18H,10-14H2,(H,21,25) |
| InChIKey | XEIKTLOVAPFGKV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |