C17H23N3O2 — CID 95276091
3-[(2S)-2-(4-methylpiperidin-1-yl)propyl]-1H-quinazoline-2,4-dione (PubChem CID 95276091) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-[(2S)-2-(4-methylpiperidin-1-yl)propyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(2S)-2-(4-methylpiperidin-1-yl)propyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 95276091 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-[(2S)-2-(4-methylpiperidin-1-yl)propyl]-1H-quinazoline-2,4-dione |
| SMILES | CC1CCN([C@@H](C)Cn2c(=O)[nH]c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C17H23N3O2/c1-12-7-9-19(10-8-12)13(2)11-20-16(21)14-5-3-4-6-15(14)18-17(20)22/h3-6,12-13H,7-11H2,1-2H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | OVBADLSOSXNALW-ZDUSSCGKSA-N |
| XLogP | 1.81 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |