C16H17N3O2S — CID 42956973
3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-1H-quinazoline-2,4-dione (PubChem CID 42956973) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 42956973 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-[2-(dimethylamino)-2-thiophen-2-ylethyl]-1H-quinazoline-2,4-dione |
| SMILES | CN(C)C(Cn1c(=O)[nH]c2ccccc2c1=O)c1cccs1 |
| InChI | InChI=1S/C16H17N3O2S/c1-18(2)13(14-8-5-9-22-14)10-19-15(20)11-6-3-4-7-12(11)17-16(19)21/h3-9,13H,10H2,1-2H3,(H,17,21) |
| InChIKey | HQNCTZOJPAVGJJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |