C18H23N3O4 — CID 51076095
3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-1H-quinazoline-2,4-dione (PubChem CID 51076095) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 51076095 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CC(C1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C18H23N3O4/c22-17-14-3-1-2-4-15(14)19-18(23)21(17)11-16(13-5-8-25-12-13)20-6-9-24-10-7-20/h1-4,13,16H,5-12H2,(H,19,23) |
| InChIKey | BCZGKGRTPCXKJO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |