C20H19N3O4 — CID 167990896
3-[[4-(morpholine-4-carbonyl)phenyl]methyl]-1H-quinazoline-2,4-dione (PubChem CID 167990896) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-[[4-(morpholine-4-carbonyl)phenyl]methyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[[4-(morpholine-4-carbonyl)phenyl]methyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 167990896 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[[4-(morpholine-4-carbonyl)phenyl]methyl]-1H-quinazoline-2,4-dione |
| SMILES | O=C(c1ccc(Cn2c(=O)[nH]c3ccccc3c2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H19N3O4/c24-18(22-9-11-27-12-10-22)15-7-5-14(6-8-15)13-23-19(25)16-3-1-2-4-17(16)21-20(23)26/h1-8H,9-13H2,(H,21,26) |
| InChIKey | JXTOSOJVKHTCTE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |