C17H19BrO — CID 23248017
[(1R,3R)-1-bromo-3-ethoxy-3-phenylpropyl]benzene (PubChem CID 23248017) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is [(1R,3R)-1-bromo-3-ethoxy-3-phenylpropyl]benzene.
| Compound Name | [(1R,3R)-1-bromo-3-ethoxy-3-phenylpropyl]benzene |
|---|---|
| PubChem CID | 23248017 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [(1R,3R)-1-bromo-3-ethoxy-3-phenylpropyl]benzene |
| SMILES | CCO[C@H](C[C@@H](Br)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19BrO/c1-2-19-17(15-11-7-4-8-12-15)13-16(18)14-9-5-3-6-10-14/h3-12,16-17H,2,13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | DZRNRLCJULZYNZ-IAGOWNOFSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|