C18H27NO6 — CID 90781892
4-(2,6-dimethoxyphenyl)-4-ethoxy-2-morpholin-4-ylbutanoic acid (PubChem CID 90781892) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-4-ethoxy-2-morpholin-4-ylbutanoic acid.
| Compound Name | 4-(2,6-dimethoxyphenyl)-4-ethoxy-2-morpholin-4-ylbutanoic acid |
|---|---|
| PubChem CID | 90781892 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-4-ethoxy-2-morpholin-4-ylbutanoic acid |
| SMILES | CCOC(CC(C(=O)O)N1CCOCC1)c1c(OC)cccc1OC |
| InChI | InChI=1S/C18H27NO6/c1-4-25-16(17-14(22-2)6-5-7-15(17)23-3)12-13(18(20)21)19-8-10-24-11-9-19/h5-7,13,16H,4,8-12H2,1-3H3,(H,20,21) |
| InChIKey | GUYJDWIYYPQSCB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |