(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate

C17H25NO5 — CID 101146486

IUPAC(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate
SMILESCC[C@H](C(=O)Oc1c(OC)cc(C)cc1OC)N1CCOCC1
InChIInChI=1S/C17H25NO5/c1-5-13(18-6-8-22-9-7-18)17(19)23-16-14(20-3)10-12(2)11-15(16)21-4/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1
InChIKeyZSNAKILYSGAMRM-CYBMUJFWSA-N
MW323.39 g/mol
LogP2.03
Rot. Bonds6

About (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate

(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate (PubChem CID 101146486) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate.

Molecular Properties

Compound Name(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate
PubChem CID101146486
Molecular FormulaC17H25NO5
Molecular Weight323.39 g/mol
Exact Mass323.17
IUPAC Name(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate
SMILESCC[C@H](C(=O)Oc1c(OC)cc(C)cc1OC)N1CCOCC1
InChIInChI=1S/C17H25NO5/c1-5-13(18-6-8-22-9-7-18)17(19)23-16-14(20-3)10-12(2)11-15(16)21-4/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1
InChIKeyZSNAKILYSGAMRM-CYBMUJFWSA-N
XLogP2.03
TPSA57.23 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.39
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate?
The IUPAC name of (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate (CID 101146486) is (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate.
What is the SMILES notation for (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate?
The canonical SMILES for (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate is CC[C@H](C(=O)Oc1c(OC)cc(C)cc1OC)N1CCOCC1.
What is the InChIKey of (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate?
The InChIKey is ZSNAKILYSGAMRM-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H25NO5/c1-5-13(18-6-8-22-9-7-18)17(19)23-16-14(20-3)10-12(2)11-15(16)21-4/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1.
What are the key properties of (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate?
(2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate has a molecular weight of 323.39 g/mol, XLogP of 2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxy-4-methylphenyl) (2R)-2-morpholin-4-ylbutanoate is sourced from PubChem (CID 101146486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).