C20H33NO6 — CID 139919274
(2,6-dimethoxy-4-methylphenyl) 2-[bis(2-methoxyethyl)amino]-3-methylbutanoate (PubChem CID 139919274) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-methoxyethyl)amino]-3-methylbutanoate.
| Compound Name | (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-methoxyethyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 139919274 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl) 2-[bis(2-methoxyethyl)amino]-3-methylbutanoate |
| SMILES | COCCN(CCOC)C(C(=O)Oc1c(OC)cc(C)cc1OC)C(C)C |
| InChI | InChI=1S/C20H33NO6/c1-14(2)18(21(8-10-23-4)9-11-24-5)20(22)27-19-16(25-6)12-15(3)13-17(19)26-7/h12-14,18H,8-11H2,1-7H3 |
| InChIKey | GWZBWCFVTWLAJZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|