C19H31NO5 — CID 57246423
(2,6-dimethoxy-4-methylphenyl) 2-[2-methoxyethyl(methyl)amino]-4-methylpentanoate (PubChem CID 57246423) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) 2-[2-methoxyethyl(methyl)amino]-4-methylpentanoate.
| Compound Name | (2,6-dimethoxy-4-methylphenyl) 2-[2-methoxyethyl(methyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 57246423 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl) 2-[2-methoxyethyl(methyl)amino]-4-methylpentanoate |
| SMILES | COCCN(C)C(CC(C)C)C(=O)Oc1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C19H31NO5/c1-13(2)10-15(20(4)8-9-22-5)19(21)25-18-16(23-6)11-14(3)12-17(18)24-7/h11-13,15H,8-10H2,1-7H3 |
| InChIKey | FHJSMMINOSVKLF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|