C13H17BrO5 — CID 91079302
(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate (PubChem CID 91079302) has the molecular formula C13H17BrO5 and a molecular weight of 333.18 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate.
| Compound Name | (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate |
|---|---|
| PubChem CID | 91079302 |
| Molecular Formula | C13H17BrO5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate |
| SMILES | COCC(Br)C(=O)Oc1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C13H17BrO5/c1-8-5-10(17-3)12(11(6-8)18-4)19-13(15)9(14)7-16-2/h5-6,9H,7H2,1-4H3 |
| InChIKey | XGQOTBCGMORGKS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|