(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate

C13H17BrO5 — CID 91079302

IUPAC(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate
SMILESCOCC(Br)C(=O)Oc1c(OC)cc(C)cc1OC
InChIInChI=1S/C13H17BrO5/c1-8-5-10(17-3)12(11(6-8)18-4)19-13(15)9(14)7-16-2/h5-6,9H,7H2,1-4H3
InChIKeyXGQOTBCGMORGKS-UHFFFAOYSA-N
MW333.18 g/mol
LogP2.33
Rot. Bonds6

About (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate

(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate (PubChem CID 91079302) has the molecular formula C13H17BrO5 and a molecular weight of 333.18 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate.

Molecular Properties

Compound Name(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate
PubChem CID91079302
Molecular FormulaC13H17BrO5
Molecular Weight333.18 g/mol
Exact Mass332.03
IUPAC Name(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate
SMILESCOCC(Br)C(=O)Oc1c(OC)cc(C)cc1OC
InChIInChI=1S/C13H17BrO5/c1-8-5-10(17-3)12(11(6-8)18-4)19-13(15)9(14)7-16-2/h5-6,9H,7H2,1-4H3
InChIKeyXGQOTBCGMORGKS-UHFFFAOYSA-N
XLogP2.33
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.18
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate?
The IUPAC name of (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate (CID 91079302) is (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate.
What is the SMILES notation for (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate?
The canonical SMILES for (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate is COCC(Br)C(=O)Oc1c(OC)cc(C)cc1OC.
What is the InChIKey of (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate?
The InChIKey is XGQOTBCGMORGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO5/c1-8-5-10(17-3)12(11(6-8)18-4)19-13(15)9(14)7-16-2/h5-6,9H,7H2,1-4H3.
What are the key properties of (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate?
(2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate has a molecular weight of 333.18 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxy-4-methylphenyl) 2-bromo-3-methoxypropanoate is sourced from PubChem (CID 91079302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).