C15H22O4 — CID 106802063
6-(2,6-dimethoxy-4-methylphenoxy)hexan-3-one (PubChem CID 106802063) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 6-(2,6-dimethoxy-4-methylphenoxy)hexan-3-one.
| Compound Name | 6-(2,6-dimethoxy-4-methylphenoxy)hexan-3-one |
|---|---|
| PubChem CID | 106802063 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-(2,6-dimethoxy-4-methylphenoxy)hexan-3-one |
| SMILES | CCC(=O)CCCOc1c(OC)cc(C)cc1OC |
| InChI | InChI=1S/C15H22O4/c1-5-12(16)7-6-8-19-15-13(17-3)9-11(2)10-14(15)18-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | IIUSNMGZUZOQHU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|