About (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate
(2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate (PubChem CID 101146490) has the molecular formula C19H31NO6
and a molecular weight of 369.46 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate |
| PubChem CID | 101146490 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate |
| SMILES | COCCN(CCOC)[C@@H](C(=O)Oc1c(OC)cccc1OC)C(C)C |
| InChI | InChI=1S/C19H31NO6/c1-14(2)17(20(10-12-22-3)11-13-23-4)19(21)26-18-15(24-5)8-7-9-16(18)25-6/h7-9,14,17H,10-13H2,1-6H3/t17-/m1/s1 |
| InChIKey | ATLKGHGKNJZFIM-QGZVFWFLSA-N |
| XLogP | 2.23 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate?
The IUPAC name of (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate (CID 101146490) is (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate.
What is the SMILES notation for (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate?
The canonical SMILES for (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate is COCCN(CCOC)[C@@H](C(=O)Oc1c(OC)cccc1OC)C(C)C.
What is the InChIKey of (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate?
The InChIKey is ATLKGHGKNJZFIM-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H31NO6/c1-14(2)17(20(10-12-22-3)11-13-23-4)19(21)26-18-15(24-5)8-7-9-16(18)25-6/h7-9,14,17H,10-13H2,1-6H3/t17-/m1/s1.
What are the key properties of (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate?
(2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate has a molecular weight of 369.46 g/mol, XLogP of 2.23, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxyphenyl) (2R)-2-[bis(2-methoxyethyl)amino]-3-methylbutanoate is sourced from PubChem (CID 101146490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).