C15H24ClNO4 — CID 74069880
(2,6-dimethoxyphenyl) 2-(diethylamino)propanoate;hydrochloride (PubChem CID 74069880) has the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 2-(diethylamino)propanoate;hydrochloride.
| Compound Name | (2,6-dimethoxyphenyl) 2-(diethylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 74069880 |
| Molecular Formula | C15H24ClNO4 |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2,6-dimethoxyphenyl) 2-(diethylamino)propanoate;hydrochloride |
| SMILES | CCN(CC)C(C)C(=O)Oc1c(OC)cccc1OC.Cl |
| InChI | InChI=1S/C15H23NO4.ClH/c1-6-16(7-2)11(3)15(17)20-14-12(18-4)9-8-10-13(14)19-5;/h8-11H,6-7H2,1-5H3;1H |
| InChIKey | KKCHUHXVGGNXFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|