C21H32O6 — CID 118321626
6-(3-butoxy-3-ethoxy-1-phenylpropoxy)-6-oxohexanoic acid (PubChem CID 118321626) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 6-(3-butoxy-3-ethoxy-1-phenylpropoxy)-6-oxohexanoic acid.
| Compound Name | 6-(3-butoxy-3-ethoxy-1-phenylpropoxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 118321626 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 6-(3-butoxy-3-ethoxy-1-phenylpropoxy)-6-oxohexanoic acid |
| SMILES | CCCCOC(CC(OC(=O)CCCCC(=O)O)c1ccccc1)OCC |
| InChI | InChI=1S/C21H32O6/c1-3-5-15-26-21(25-4-2)16-18(17-11-7-6-8-12-17)27-20(24)14-10-9-13-19(22)23/h6-8,11-12,18,21H,3-5,9-10,13-16H2,1-2H3,(H,22,23) |
| InChIKey | ROBPMMQHLDBPJB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|