C21H33NO4 — CID 3738420
(2-amino-3-ethoxy-3-oxo-1-phenylpropyl) decanoate (PubChem CID 3738420) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is (2-amino-3-ethoxy-3-oxo-1-phenylpropyl) decanoate.
| Compound Name | (2-amino-3-ethoxy-3-oxo-1-phenylpropyl) decanoate |
|---|---|
| PubChem CID | 3738420 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (2-amino-3-ethoxy-3-oxo-1-phenylpropyl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC(c1ccccc1)C(N)C(=O)OCC |
| InChI | InChI=1S/C21H33NO4/c1-3-5-6-7-8-9-13-16-18(23)26-20(17-14-11-10-12-15-17)19(22)21(24)25-4-2/h10-12,14-15,19-20H,3-9,13,16,22H2,1-2H3 |
| InChIKey | ZCXIBBJMNPJGQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|