C19H30ClNO4 — CID 52993339
[(1S,2R)-2-amino-3-ethoxy-3-oxo-1-phenylpropyl] octanoate;hydrochloride (PubChem CID 52993339) has the molecular formula C19H30ClNO4 and a molecular weight of 371.91 g/mol. Its IUPAC name is [(1S,2R)-2-amino-3-ethoxy-3-oxo-1-phenylpropyl] octanoate;hydrochloride.
| Compound Name | [(1S,2R)-2-amino-3-ethoxy-3-oxo-1-phenylpropyl] octanoate;hydrochloride |
|---|---|
| PubChem CID | 52993339 |
| Molecular Formula | C19H30ClNO4 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [(1S,2R)-2-amino-3-ethoxy-3-oxo-1-phenylpropyl] octanoate;hydrochloride |
| SMILES | CCCCCCCC(=O)O[C@@H](c1ccccc1)[C@@H](N)C(=O)OCC.Cl |
| InChI | InChI=1S/C19H29NO4.ClH/c1-3-5-6-7-11-14-16(21)24-18(15-12-9-8-10-13-15)17(20)19(22)23-4-2;/h8-10,12-13,17-18H,3-7,11,14,20H2,1-2H3;1H/t17-,18+;/m1./s1 |
| InChIKey | CLDIAGDKTXFKBT-URBRKQAFSA-N |
| XLogP | 3.94 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|