C17H27NO3 — CID 118589322
4,4-diethoxy-2-methyl-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 118589322) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4,4-diethoxy-2-methyl-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | 4,4-diethoxy-2-methyl-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 118589322 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 4,4-diethoxy-2-methyl-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | CCOC(CC(C)C(=O)N[C@H](C)c1ccccc1)OCC |
| InChI | InChI=1S/C17H27NO3/c1-5-20-16(21-6-2)12-13(3)17(19)18-14(4)15-10-8-7-9-11-15/h7-11,13-14,16H,5-6,12H2,1-4H3,(H,18,19)/t13?,14-/m1/s1 |
| InChIKey | LHUCMSFPGZWYHD-ARLHGKGLSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|