C20H18O — CID 14925232
(E)-6,8-diphenyloct-5-en-7-yn-2-one (PubChem CID 14925232) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-6,8-diphenyloct-5-en-7-yn-2-one.
| Compound Name | (E)-6,8-diphenyloct-5-en-7-yn-2-one |
|---|---|
| PubChem CID | 14925232 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (E)-6,8-diphenyloct-5-en-7-yn-2-one |
| SMILES | CC(=O)CC/C=C(/C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O/c1-17(21)9-8-14-20(19-12-6-3-7-13-19)16-15-18-10-4-2-5-11-18/h2-7,10-14H,8-9H2,1H3/b20-14- |
| InChIKey | WDGSHTLXWPFSQD-ZHZULCJRSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|