C25H26O — CID 71769457
(3E,6E)-1,3-diphenyl-6-propyldeca-3,6-dien-1-yn-5-one (PubChem CID 71769457) has the molecular formula C25H26O and a molecular weight of 342.48 g/mol. Its IUPAC name is (3E,6E)-1,3-diphenyl-6-propyldeca-3,6-dien-1-yn-5-one.
| Compound Name | (3E,6E)-1,3-diphenyl-6-propyldeca-3,6-dien-1-yn-5-one |
|---|---|
| PubChem CID | 71769457 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (3E,6E)-1,3-diphenyl-6-propyldeca-3,6-dien-1-yn-5-one |
| SMILES | CCC/C=C(\CCC)C(=O)/C=C(/C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26O/c1-3-5-15-23(12-4-2)25(26)20-24(22-16-10-7-11-17-22)19-18-21-13-8-6-9-14-21/h6-11,13-17,20H,3-5,12H2,1-2H3/b23-15+,24-20- |
| InChIKey | FVYHGCDNVRFHRK-XZIKTUPWSA-N |
| XLogP | 6.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|