C21H21NO3 — CID 18517080
2-[[(E)-5-(4-methoxyphenyl)-3-phenylpent-2-en-4-ynyl]-methylamino]acetic acid (PubChem CID 18517080) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[[(E)-5-(4-methoxyphenyl)-3-phenylpent-2-en-4-ynyl]-methylamino]acetic acid.
| Compound Name | 2-[[(E)-5-(4-methoxyphenyl)-3-phenylpent-2-en-4-ynyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 18517080 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[[(E)-5-(4-methoxyphenyl)-3-phenylpent-2-en-4-ynyl]-methylamino]acetic acid |
| SMILES | COc1ccc(C#C/C(=C/CN(C)CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-22(16-21(23)24)15-14-19(18-6-4-3-5-7-18)11-8-17-9-12-20(25-2)13-10-17/h3-7,9-10,12-14H,15-16H2,1-2H3,(H,23,24)/b19-14- |
| InChIKey | LSJKVTYGISSIJH-RGEXLXHISA-N |
| XLogP | 3.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|