C17H22FNO2Si — CID 90797501
2-[[3-(4-fluorophenyl)-5-trimethylsilylpent-2-en-4-ynyl]-methylamino]acetic acid (PubChem CID 90797501) has the molecular formula C17H22FNO2Si and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-5-trimethylsilylpent-2-en-4-ynyl]-methylamino]acetic acid.
| Compound Name | 2-[[3-(4-fluorophenyl)-5-trimethylsilylpent-2-en-4-ynyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 90797501 |
| Molecular Formula | C17H22FNO2Si |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-5-trimethylsilylpent-2-en-4-ynyl]-methylamino]acetic acid |
| SMILES | CN(CC=C(C#C[Si](C)(C)C)c1ccc(F)cc1)CC(=O)O |
| InChI | InChI=1S/C17H22FNO2Si/c1-19(13-17(20)21)11-9-15(10-12-22(2,3)4)14-5-7-16(18)8-6-14/h5-9H,11,13H2,1-4H3,(H,20,21) |
| InChIKey | ADBAPBBKVYNJFS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|