C26H28N2O — CID 143247598
2-[[(E)-5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3-phenylpent-2-en-4-ynyl]-methylamino]acetamide (PubChem CID 143247598) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[[(E)-5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3-phenylpent-2-en-4-ynyl]-methylamino]acetamide.
| Compound Name | 2-[[(E)-5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3-phenylpent-2-en-4-ynyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 143247598 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-[[(E)-5-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-3-phenylpent-2-en-4-ynyl]-methylamino]acetamide |
| SMILES | C/C=C\C(=C/C)c1ccc(C#C/C(=C/CN(C)CC(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O/c1-4-9-22(5-2)24-15-12-21(13-16-24)14-17-25(23-10-7-6-8-11-23)18-19-28(3)20-26(27)29/h4-13,15-16,18H,19-20H2,1-3H3,(H2,27,29)/b9-4-,22-5+,25-18- |
| InChIKey | VEPIVUUGAROCHK-GBESDKEBSA-N |
| XLogP | 4.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|