C24H21NO2 — CID 18517051
2-[methyl-[(E)-5-naphthalen-1-yl-3-phenylpent-2-en-4-ynyl]amino]acetic acid (PubChem CID 18517051) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[methyl-[(E)-5-naphthalen-1-yl-3-phenylpent-2-en-4-ynyl]amino]acetic acid.
| Compound Name | 2-[methyl-[(E)-5-naphthalen-1-yl-3-phenylpent-2-en-4-ynyl]amino]acetic acid |
|---|---|
| PubChem CID | 18517051 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[methyl-[(E)-5-naphthalen-1-yl-3-phenylpent-2-en-4-ynyl]amino]acetic acid |
| SMILES | CN(C/C=C(/C#Cc1cccc2ccccc12)c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C24H21NO2/c1-25(18-24(26)27)17-16-20(19-8-3-2-4-9-19)14-15-22-12-7-11-21-10-5-6-13-23(21)22/h2-13,16H,17-18H2,1H3,(H,26,27)/b20-16- |
| InChIKey | DIAWDCJXECNMKZ-SILNSSARSA-N |
| XLogP | 4.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|