C23H24ClNO2 — CID 85336220
2-[[3-(2-chlorophenyl)-5-(4-propylphenyl)pent-2-en-4-ynyl]-methylamino]acetic acid (PubChem CID 85336220) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is 2-[[3-(2-chlorophenyl)-5-(4-propylphenyl)pent-2-en-4-ynyl]-methylamino]acetic acid.
| Compound Name | 2-[[3-(2-chlorophenyl)-5-(4-propylphenyl)pent-2-en-4-ynyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 85336220 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[3-(2-chlorophenyl)-5-(4-propylphenyl)pent-2-en-4-ynyl]-methylamino]acetic acid |
| SMILES | CCCc1ccc(C#CC(=CCN(C)CC(=O)O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H24ClNO2/c1-3-6-18-9-11-19(12-10-18)13-14-20(15-16-25(2)17-23(26)27)21-7-4-5-8-22(21)24/h4-5,7-12,15H,3,6,16-17H2,1-2H3,(H,26,27) |
| InChIKey | UJACLHZGYAYKTK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|