C16H19NO2 — CID 11780164
(3R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-phenylpent-1-yn-3-ol (PubChem CID 11780164) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-phenylpent-1-yn-3-ol.
| Compound Name | (3R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-phenylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 11780164 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3R,4S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-phenylpent-1-yn-3-ol |
| SMILES | C[C@H](C1=NC(C)(C)CO1)[C@@H](O)C#Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-12(15-17-16(2,3)11-19-15)14(18)10-9-13-7-5-4-6-8-13/h4-8,12,14,18H,11H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | SVHJRMIPCCAMBL-JSGCOSHPSA-N |
| XLogP | 2.24 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|