C11H13NOS — CID 13047578
4,4-dimethyl-2-phenylsulfanyl-5H-1,3-oxazole (PubChem CID 13047578) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenylsulfanyl-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-phenylsulfanyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 13047578 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 4,4-dimethyl-2-phenylsulfanyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(Sc2ccccc2)=N1 |
| InChI | InChI=1S/C11H13NOS/c1-11(2)8-13-10(12-11)14-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | AHRWLXYATHJEBN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |