C13H17NOS — CID 132508765
4-butan-2-yl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole (PubChem CID 132508765) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-butan-2-yl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-butan-2-yl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132508765 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-butan-2-yl-2-phenylsulfanyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC(C)C1COC(Sc2ccccc2)=N1 |
| InChI | InChI=1S/C13H17NOS/c1-3-10(2)12-9-15-13(14-12)16-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3 |
| InChIKey | DVCODVHKQBONGD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |