C19H16O — CID 10730067
(3-ethoxy-5-phenylpenta-1,4-diynyl)benzene (PubChem CID 10730067) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is (3-ethoxy-5-phenylpenta-1,4-diynyl)benzene.
| Compound Name | (3-ethoxy-5-phenylpenta-1,4-diynyl)benzene |
|---|---|
| PubChem CID | 10730067 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (3-ethoxy-5-phenylpenta-1,4-diynyl)benzene |
| SMILES | CCOC(C#Cc1ccccc1)C#Cc1ccccc1 |
| InChI | InChI=1S/C19H16O/c1-2-20-19(15-13-17-9-5-3-6-10-17)16-14-18-11-7-4-8-12-18/h3-12,19H,2H2,1H3 |
| InChIKey | RZKDJOLHWZYIHX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|