C13H15BrO2 — CID 176563182
1-bromo-3-(3,3-diethoxyprop-1-ynyl)benzene (PubChem CID 176563182) has the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-bromo-3-(3,3-diethoxyprop-1-ynyl)benzene.
| Compound Name | 1-bromo-3-(3,3-diethoxyprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 176563182 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-bromo-3-(3,3-diethoxyprop-1-ynyl)benzene |
| SMILES | CCOC(C#Cc1cccc(Br)c1)OCC |
| InChI | InChI=1S/C13H15BrO2/c1-3-15-13(16-4-2)9-8-11-6-5-7-12(14)10-11/h5-7,10,13H,3-4H2,1-2H3 |
| InChIKey | BMOPNYHPBLBDQW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|