C19H16Co2O8 — CID 11329316
carbon monoxide;cobalt;3,3-diethoxyprop-1-ynylbenzene (PubChem CID 11329316) has the molecular formula C19H16Co2O8 and a molecular weight of 490.20 g/mol. Its IUPAC name is carbon monoxide;cobalt;3,3-diethoxyprop-1-ynylbenzene.
| Compound Name | carbon monoxide;cobalt;3,3-diethoxyprop-1-ynylbenzene |
|---|---|
| PubChem CID | 11329316 |
| Molecular Formula | C19H16Co2O8 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | carbon monoxide;cobalt;3,3-diethoxyprop-1-ynylbenzene |
| SMILES | CCOC(C#Cc1ccccc1)OCC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C13H16O2.6CO.2Co/c1-3-14-13(15-4-2)11-10-12-8-6-5-7-9-12;6*1-2;;/h5-9,13H,3-4H2,1-2H3;;;;;;;; |
| InChIKey | OKFVJVJATJFCSX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 137.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|