C21H26Si — CID 166443845
1,3-diphenylprop-2-ynyl(triethyl)silane (PubChem CID 166443845) has the molecular formula C21H26Si and a molecular weight of 306.53 g/mol. Its IUPAC name is 1,3-diphenylprop-2-ynyl(triethyl)silane.
| Compound Name | 1,3-diphenylprop-2-ynyl(triethyl)silane |
|---|---|
| PubChem CID | 166443845 |
| Molecular Formula | C21H26Si |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1,3-diphenylprop-2-ynyl(triethyl)silane |
| SMILES | CC[Si](CC)(CC)C(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26Si/c1-4-22(5-2,6-3)21(20-15-11-8-12-16-20)18-17-19-13-9-7-10-14-19/h7-16,21H,4-6H2,1-3H3 |
| InChIKey | HBUBVMAEAFXSAM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|