C11H19LiN2Si — CID 173472565
lithium N,N,N',N'-tetramethyl-1-phenylsilylmethanediamine (PubChem CID 173472565) has the molecular formula C11H19LiN2Si and a molecular weight of 214.31 g/mol. Its IUPAC name is lithium N,N,N',N'-tetramethyl-1-phenylsilylmethanediamine.
| Compound Name | lithium N,N,N',N'-tetramethyl-1-phenylsilylmethanediamine |
|---|---|
| PubChem CID | 173472565 |
| Molecular Formula | C11H19LiN2Si |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | lithium N,N,N',N'-tetramethyl-1-phenylsilylmethanediamine |
| SMILES | CN(C)[C-]([SiH2]c1ccccc1)N(C)C.[Li+] |
| InChI | InChI=1S/C11H19N2Si.Li/c1-12(2)11(13(3)4)14-10-8-6-5-7-9-10;/h5-9H,14H2,1-4H3;/q-1;+1 |
| InChIKey | BWZXZWIXNGZHDV-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|