C14H20N2O2S — CID 100665662
2,2-dimethyl-N'-[(2S)-2-phenylsulfanylpropyl]propanediamide (PubChem CID 100665662) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2,2-dimethyl-N'-[(2S)-2-phenylsulfanylpropyl]propanediamide.
| Compound Name | 2,2-dimethyl-N'-[(2S)-2-phenylsulfanylpropyl]propanediamide |
|---|---|
| PubChem CID | 100665662 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2,2-dimethyl-N'-[(2S)-2-phenylsulfanylpropyl]propanediamide |
| SMILES | C[C@@H](CNC(=O)C(C)(C)C(N)=O)Sc1ccccc1 |
| InChI | InChI=1S/C14H20N2O2S/c1-10(19-11-7-5-4-6-8-11)9-16-13(18)14(2,3)12(15)17/h4-8,10H,9H2,1-3H3,(H2,15,17)(H,16,18)/t10-/m0/s1 |
| InChIKey | ADDOPPKCBLOECO-JTQLQIEISA-N |
| XLogP | 1.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|