C13H20N2O2S — CID 111508832
1-(3-hydroxypropyl)-3-(2-phenylsulfanylpropyl)urea (PubChem CID 111508832) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(2-phenylsulfanylpropyl)urea.
| Compound Name | 1-(3-hydroxypropyl)-3-(2-phenylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 111508832 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(2-phenylsulfanylpropyl)urea |
| SMILES | CC(CNC(=O)NCCCO)Sc1ccccc1 |
| InChI | InChI=1S/C13H20N2O2S/c1-11(18-12-6-3-2-4-7-12)10-15-13(17)14-8-5-9-16/h2-4,6-7,11,16H,5,8-10H2,1H3,(H2,14,15,17) |
| InChIKey | YQWIHTZQJQNRDT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|