C16H26N2O2S — CID 111508829
1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-phenylsulfanylpropyl)urea (PubChem CID 111508829) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-phenylsulfanylpropyl)urea.
| Compound Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-phenylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 111508829 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-(1-hydroxy-4-methylpentan-3-yl)-3-(2-phenylsulfanylpropyl)urea |
| SMILES | CC(CNC(=O)NC(CCO)C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2S/c1-12(2)15(9-10-19)18-16(20)17-11-13(3)21-14-7-5-4-6-8-14/h4-8,12-13,15,19H,9-11H2,1-3H3,(H2,17,18,20) |
| InChIKey | FLQYBBZIOANLDX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |