C16H25FN2O3 — CID 111508432
1-[2-(3-fluorophenoxy)propyl]-3-(1-hydroxy-4-methylpentan-3-yl)urea (PubChem CID 111508432) has the molecular formula C16H25FN2O3 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)propyl]-3-(1-hydroxy-4-methylpentan-3-yl)urea.
| Compound Name | 1-[2-(3-fluorophenoxy)propyl]-3-(1-hydroxy-4-methylpentan-3-yl)urea |
|---|---|
| PubChem CID | 111508432 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)propyl]-3-(1-hydroxy-4-methylpentan-3-yl)urea |
| SMILES | CC(CNC(=O)NC(CCO)C(C)C)Oc1cccc(F)c1 |
| InChI | InChI=1S/C16H25FN2O3/c1-11(2)15(7-8-20)19-16(21)18-10-12(3)22-14-6-4-5-13(17)9-14/h4-6,9,11-12,15,20H,7-8,10H2,1-3H3,(H2,18,19,21) |
| InChIKey | ZEFJXOGTUNIWDV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |