C11H11F3O2S2 — CID 101101413
1-(4-methylsulfanylphenyl)sulfanylethyl 2,2,2-trifluoroacetate (PubChem CID 101101413) has the molecular formula C11H11F3O2S2 and a molecular weight of 296.34 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)sulfanylethyl 2,2,2-trifluoroacetate.
| Compound Name | 1-(4-methylsulfanylphenyl)sulfanylethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 101101413 |
| Molecular Formula | C11H11F3O2S2 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)sulfanylethyl 2,2,2-trifluoroacetate |
| SMILES | CSc1ccc(SC(C)OC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3O2S2/c1-7(16-10(15)11(12,13)14)18-9-5-3-8(17-2)4-6-9/h3-7H,1-2H3 |
| InChIKey | BCFCWHWTMCOCJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|