C18H26N2O3 — CID 175254231
methyl 4-[1-(2-amino-2-oxo-1-phenylethyl)piperidin-4-yl]butanoate (PubChem CID 175254231) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 4-[1-(2-amino-2-oxo-1-phenylethyl)piperidin-4-yl]butanoate.
| Compound Name | methyl 4-[1-(2-amino-2-oxo-1-phenylethyl)piperidin-4-yl]butanoate |
|---|---|
| PubChem CID | 175254231 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | methyl 4-[1-(2-amino-2-oxo-1-phenylethyl)piperidin-4-yl]butanoate |
| SMILES | COC(=O)CCCC1CCN(C(C(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-23-16(21)9-5-6-14-10-12-20(13-11-14)17(18(19)22)15-7-3-2-4-8-15/h2-4,7-8,14,17H,5-6,9-13H2,1H3,(H2,19,22) |
| InChIKey | CQZOSMVNVOMZLI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |