C28H35NO6 — CID 156533867
trimethyl 2-[(1-benzhydrylpiperidin-4-yl)methyl]propane-1,1,3-tricarboxylate (PubChem CID 156533867) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is trimethyl 2-[(1-benzhydrylpiperidin-4-yl)methyl]propane-1,1,3-tricarboxylate.
| Compound Name | trimethyl 2-[(1-benzhydrylpiperidin-4-yl)methyl]propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 156533867 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | trimethyl 2-[(1-benzhydrylpiperidin-4-yl)methyl]propane-1,1,3-tricarboxylate |
| SMILES | COC(=O)CC(CC1CCN(C(c2ccccc2)c2ccccc2)CC1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C28H35NO6/c1-33-24(30)19-23(25(27(31)34-2)28(32)35-3)18-20-14-16-29(17-15-20)26(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,20,23,25-26H,14-19H2,1-3H3 |
| InChIKey | HRHUMGQLLWTBKT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|