C31H38N4O2 — CID 67763797
N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[butyl(carbamoyl)amino]benzamide (PubChem CID 67763797) has the molecular formula C31H38N4O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[butyl(carbamoyl)amino]benzamide.
| Compound Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[butyl(carbamoyl)amino]benzamide |
|---|---|
| PubChem CID | 67763797 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | N-[(1-benzhydrylpiperidin-4-yl)methyl]-2-[butyl(carbamoyl)amino]benzamide |
| SMILES | CCCCN(C(N)=O)c1ccccc1C(=O)NCC1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H38N4O2/c1-2-3-20-35(31(32)37)28-17-11-10-16-27(28)30(36)33-23-24-18-21-34(22-19-24)29(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-17,24,29H,2-3,18-23H2,1H3,(H2,32,37)(H,33,36) |
| InChIKey | BCCDDIZRQHBRBM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |